C14H11F2N3O6S — CID 133297899
4-(difluoromethylsulfonyl)-2-nitro-N-[(4-nitrophenyl)methyl]aniline (PubChem CID 133297899) has the molecular formula C14H11F2N3O6S and a molecular weight of 387.32 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-2-nitro-N-[(4-nitrophenyl)methyl]aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-2-nitro-N-[(4-nitrophenyl)methyl]aniline |
|---|---|
| PubChem CID | 133297899 |
| Molecular Formula | C14H11F2N3O6S |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-2-nitro-N-[(4-nitrophenyl)methyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(CNc2ccc(S(=O)(=O)C(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H11F2N3O6S/c15-14(16)26(24,25)11-5-6-12(13(7-11)19(22)23)17-8-9-1-3-10(4-2-9)18(20)21/h1-7,14,17H,8H2 |
| InChIKey | FRAQOSGOBRKQIP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|