C13H12F2N4O5S — CID 133498007
N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-4-(difluoromethylsulfonyl)-2-nitroaniline (PubChem CID 133498007) has the molecular formula C13H12F2N4O5S and a molecular weight of 374.33 g/mol. Its IUPAC name is N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-4-(difluoromethylsulfonyl)-2-nitroaniline.
| Compound Name | N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-4-(difluoromethylsulfonyl)-2-nitroaniline |
|---|---|
| PubChem CID | 133498007 |
| Molecular Formula | C13H12F2N4O5S |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-4-(difluoromethylsulfonyl)-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)F)ccc1NCc1nnc(C2CC2)o1 |
| InChI | InChI=1S/C13H12F2N4O5S/c14-13(15)25(22,23)8-3-4-9(10(5-8)19(20)21)16-6-11-17-18-12(24-11)7-1-2-7/h3-5,7,13,16H,1-2,6H2 |
| InChIKey | FGYXKFSYLDLPIM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|