C16H16F2N2O4S — CID 133297569
4-(difluoromethylsulfonyl)-N-[(2,4-dimethylphenyl)methyl]-2-nitroaniline (PubChem CID 133297569) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(2,4-dimethylphenyl)methyl]-2-nitroaniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(2,4-dimethylphenyl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 133297569 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(2,4-dimethylphenyl)methyl]-2-nitroaniline |
| SMILES | Cc1ccc(CNc2ccc(S(=O)(=O)C(F)F)cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C16H16F2N2O4S/c1-10-3-4-12(11(2)7-10)9-19-14-6-5-13(8-15(14)20(21)22)25(23,24)16(17)18/h3-8,16,19H,9H2,1-2H3 |
| InChIKey | QNHHOQKNZYITSQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|