C17H14F2N4O4S — CID 133299297
4-(difluoromethylsulfonyl)-2-nitro-N-[(2-pyrazol-1-ylphenyl)methyl]aniline (PubChem CID 133299297) has the molecular formula C17H14F2N4O4S and a molecular weight of 408.39 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-2-nitro-N-[(2-pyrazol-1-ylphenyl)methyl]aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-2-nitro-N-[(2-pyrazol-1-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 133299297 |
| Molecular Formula | C17H14F2N4O4S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-2-nitro-N-[(2-pyrazol-1-ylphenyl)methyl]aniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)F)ccc1NCc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C17H14F2N4O4S/c18-17(19)28(26,27)13-6-7-14(16(10-13)23(24)25)20-11-12-4-1-2-5-15(12)22-9-3-8-21-22/h1-10,17,20H,11H2 |
| InChIKey | MYOPYSPVUVMZFD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|