C12H13N5O5 — CID 136575248
2-[4-[(2,4-dinitroanilino)methyl]pyrazol-1-yl]ethanol (PubChem CID 136575248) has the molecular formula C12H13N5O5 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-[4-[(2,4-dinitroanilino)methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[(2,4-dinitroanilino)methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 136575248 |
| Molecular Formula | C12H13N5O5 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[4-[(2,4-dinitroanilino)methyl]pyrazol-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(NCc2cnn(CCO)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N5O5/c18-4-3-15-8-9(7-14-15)6-13-11-2-1-10(16(19)20)5-12(11)17(21)22/h1-2,5,7-8,13,18H,3-4,6H2 |
| InChIKey | IREJACOUYPTFQD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|