C13H15ClN4O2 — CID 103571413
2-chloro-5-nitro-N-[(1-propylpyrazol-4-yl)methyl]aniline (PubChem CID 103571413) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[(1-propylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2-chloro-5-nitro-N-[(1-propylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 103571413 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-chloro-5-nitro-N-[(1-propylpyrazol-4-yl)methyl]aniline |
| SMILES | CCCn1cc(CNc2cc([N+](=O)[O-])ccc2Cl)cn1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-2-5-17-9-10(8-16-17)7-15-13-6-11(18(19)20)3-4-12(13)14/h3-4,6,8-9,15H,2,5,7H2,1H3 |
| InChIKey | LEUCWKNJGQYFKC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|