C15H18ClN3O2 — CID 103880772
6-chloro-N-[(1-propylpyrazol-4-yl)methyl]-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 103880772) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 6-chloro-N-[(1-propylpyrazol-4-yl)methyl]-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-chloro-N-[(1-propylpyrazol-4-yl)methyl]-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 103880772 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 6-chloro-N-[(1-propylpyrazol-4-yl)methyl]-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | CCCn1cc(CNc2cc3c(cc2Cl)OCCO3)cn1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-2-3-19-10-11(9-18-19)8-17-13-7-15-14(6-12(13)16)20-4-5-21-15/h6-7,9-10,17H,2-5,8H2,1H3 |
| InChIKey | HPQKJQIJBHNWFY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|