C13H15ClN4O3 — CID 66270739
2-[4-[[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]triazol-1-yl]ethanol (PubChem CID 66270739) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is 2-[4-[[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66270739 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[4-[[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2cc3c(cc2Cl)OCCO3)nn1 |
| InChI | InChI=1S/C13H15ClN4O3/c14-10-5-12-13(21-4-3-20-12)6-11(10)15-7-9-8-18(1-2-19)17-16-9/h5-6,8,15,19H,1-4,7H2 |
| InChIKey | HJVWNVDRGOZUDI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|