C11H11ClN4O2 — CID 62756856
6-chloro-N-[(1-methyltriazol-4-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 62756856) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 6-chloro-N-[(1-methyltriazol-4-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-[(1-methyltriazol-4-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 62756856 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 6-chloro-N-[(1-methyltriazol-4-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Cn1cc(CNc2cc3c(cc2Cl)OCO3)nn1 |
| InChI | InChI=1S/C11H11ClN4O2/c1-16-5-7(14-15-16)4-13-9-3-11-10(2-8(9)12)17-6-18-11/h2-3,5,13H,4,6H2,1H3 |
| InChIKey | PDCITQOYJRWFFH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|