C16H16ClNO2 — CID 63429722
6-chloro-N-[(2,5-dimethylphenyl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 63429722) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 6-chloro-N-[(2,5-dimethylphenyl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-[(2,5-dimethylphenyl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 63429722 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 6-chloro-N-[(2,5-dimethylphenyl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1ccc(C)c(CNc2cc3c(cc2Cl)OCO3)c1 |
| InChI | InChI=1S/C16H16ClNO2/c1-10-3-4-11(2)12(5-10)8-18-14-7-16-15(6-13(14)17)19-9-20-16/h3-7,18H,8-9H2,1-2H3 |
| InChIKey | WWKFQNBDZUHYAN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|