About 6-chloro-N-pentyl-1,3-benzodioxol-5-amine
6-chloro-N-pentyl-1,3-benzodioxol-5-amine (PubChem CID 43685737) has the molecular formula C12H16ClNO2
and a molecular weight of 241.72 g/mol. Its IUPAC name is 6-chloro-N-pentyl-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | 6-chloro-N-pentyl-1,3-benzodioxol-5-amine |
| PubChem CID | 43685737 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-chloro-N-pentyl-1,3-benzodioxol-5-amine |
| SMILES | CCCCCNc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C12H16ClNO2/c1-2-3-4-5-14-10-7-12-11(6-9(10)13)15-8-16-12/h6-7,14H,2-5,8H2,1H3 |
| InChIKey | DPCSSNVVZCQILJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-pentyl-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-pentyl-1,3-benzodioxol-5-amine?
The IUPAC name of 6-chloro-N-pentyl-1,3-benzodioxol-5-amine (CID 43685737) is 6-chloro-N-pentyl-1,3-benzodioxol-5-amine.
What is the SMILES notation for 6-chloro-N-pentyl-1,3-benzodioxol-5-amine?
The canonical SMILES for 6-chloro-N-pentyl-1,3-benzodioxol-5-amine is CCCCCNc1cc2c(cc1Cl)OCO2.
What is the InChIKey of 6-chloro-N-pentyl-1,3-benzodioxol-5-amine?
The InChIKey is DPCSSNVVZCQILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO2/c1-2-3-4-5-14-10-7-12-11(6-9(10)13)15-8-16-12/h6-7,14H,2-5,8H2,1H3.
What are the key properties of 6-chloro-N-pentyl-1,3-benzodioxol-5-amine?
6-chloro-N-pentyl-1,3-benzodioxol-5-amine has a molecular weight of 241.72 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-pentyl-1,3-benzodioxol-5-amine is sourced from PubChem (CID 43685737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).