C11H15NO2S — CID 115224661
3-[(6-methyl-1,3-benzodioxol-5-yl)amino]propane-1-thiol (PubChem CID 115224661) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 3-[(6-methyl-1,3-benzodioxol-5-yl)amino]propane-1-thiol.
| Compound Name | 3-[(6-methyl-1,3-benzodioxol-5-yl)amino]propane-1-thiol |
|---|---|
| PubChem CID | 115224661 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-[(6-methyl-1,3-benzodioxol-5-yl)amino]propane-1-thiol |
| SMILES | Cc1cc2c(cc1NCCCS)OCO2 |
| InChI | InChI=1S/C11H15NO2S/c1-8-5-10-11(14-7-13-10)6-9(8)12-3-2-4-15/h5-6,12,15H,2-4,7H2,1H3 |
| InChIKey | HNWXUBMJDPLCPA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|