C11H14ClNO2 — CID 115214886
2-chloro-N-[(6-methyl-1,3-benzodioxol-5-yl)methyl]ethanamine (PubChem CID 115214886) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-chloro-N-[(6-methyl-1,3-benzodioxol-5-yl)methyl]ethanamine.
| Compound Name | 2-chloro-N-[(6-methyl-1,3-benzodioxol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115214886 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-chloro-N-[(6-methyl-1,3-benzodioxol-5-yl)methyl]ethanamine |
| SMILES | Cc1cc2c(cc1CNCCCl)OCO2 |
| InChI | InChI=1S/C11H14ClNO2/c1-8-4-10-11(15-7-14-10)5-9(8)6-13-3-2-12/h4-5,13H,2-3,6-7H2,1H3 |
| InChIKey | FUVMYBOLQGNHKF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|