C10H12ClNO2 — CID 165438493
N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]ethanamine (PubChem CID 165438493) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]ethanamine.
| Compound Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 165438493 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]ethanamine |
| SMILES | CCNCc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C10H12ClNO2/c1-2-12-5-7-3-9-10(4-8(7)11)14-6-13-9/h3-4,12H,2,5-6H2,1H3 |
| InChIKey | UXPAAAJEZUVNLA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |