C13H20N2O2 — CID 115203011
2-methyl-N'-(6-methyl-1,3-benzodioxol-5-yl)butane-1,4-diamine (PubChem CID 115203011) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-methyl-N'-(6-methyl-1,3-benzodioxol-5-yl)butane-1,4-diamine.
| Compound Name | 2-methyl-N'-(6-methyl-1,3-benzodioxol-5-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 115203011 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-methyl-N'-(6-methyl-1,3-benzodioxol-5-yl)butane-1,4-diamine |
| SMILES | Cc1cc2c(cc1NCCC(C)CN)OCO2 |
| InChI | InChI=1S/C13H20N2O2/c1-9(7-14)3-4-15-11-6-13-12(5-10(11)2)16-8-17-13/h5-6,9,15H,3-4,7-8,14H2,1-2H3 |
| InChIKey | HHNUKHNDCFBCJS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|