C12H18N2O2 — CID 115131703
2-methyl-2-N-(6-methyl-1,3-benzodioxol-5-yl)propane-1,2-diamine (PubChem CID 115131703) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-methyl-2-N-(6-methyl-1,3-benzodioxol-5-yl)propane-1,2-diamine.
| Compound Name | 2-methyl-2-N-(6-methyl-1,3-benzodioxol-5-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115131703 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-methyl-2-N-(6-methyl-1,3-benzodioxol-5-yl)propane-1,2-diamine |
| SMILES | Cc1cc2c(cc1NC(C)(C)CN)OCO2 |
| InChI | InChI=1S/C12H18N2O2/c1-8-4-10-11(16-7-15-10)5-9(8)14-12(2,3)6-13/h4-5,14H,6-7,13H2,1-3H3 |
| InChIKey | CIEDNWBXRQJBBV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|