C12H17NO3 — CID 115136804
2-methyl-1-[(6-methyl-1,3-benzodioxol-5-yl)amino]propan-2-ol (PubChem CID 115136804) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-methyl-1-[(6-methyl-1,3-benzodioxol-5-yl)amino]propan-2-ol.
| Compound Name | 2-methyl-1-[(6-methyl-1,3-benzodioxol-5-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 115136804 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-methyl-1-[(6-methyl-1,3-benzodioxol-5-yl)amino]propan-2-ol |
| SMILES | Cc1cc2c(cc1NCC(C)(C)O)OCO2 |
| InChI | InChI=1S/C12H17NO3/c1-8-4-10-11(16-7-15-10)5-9(8)13-6-12(2,3)14/h4-5,13-14H,6-7H2,1-3H3 |
| InChIKey | WKHJYIPHIWOPOF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|