C13H15NO5 — CID 115163959
2,2-dimethyl-3-[(6-methyl-1,3-benzodioxol-5-yl)amino]-3-oxopropanoic acid (PubChem CID 115163959) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(6-methyl-1,3-benzodioxol-5-yl)amino]-3-oxopropanoic acid.
| Compound Name | 2,2-dimethyl-3-[(6-methyl-1,3-benzodioxol-5-yl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115163959 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2,2-dimethyl-3-[(6-methyl-1,3-benzodioxol-5-yl)amino]-3-oxopropanoic acid |
| SMILES | Cc1cc2c(cc1NC(=O)C(C)(C)C(=O)O)OCO2 |
| InChI | InChI=1S/C13H15NO5/c1-7-4-9-10(19-6-18-9)5-8(7)14-11(15)13(2,3)12(16)17/h4-5H,6H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | WZZOBRRXHPCXSQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|