C12H15NO4 — CID 115219286
2-methyl-3-[(6-methyl-1,3-benzodioxol-5-yl)amino]propanoic acid (PubChem CID 115219286) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-methyl-3-[(6-methyl-1,3-benzodioxol-5-yl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[(6-methyl-1,3-benzodioxol-5-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 115219286 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-methyl-3-[(6-methyl-1,3-benzodioxol-5-yl)amino]propanoic acid |
| SMILES | Cc1cc2c(cc1NCC(C)C(=O)O)OCO2 |
| InChI | InChI=1S/C12H15NO4/c1-7-3-10-11(17-6-16-10)4-9(7)13-5-8(2)12(14)15/h3-4,8,13H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | NBTQAWBEOHQMNZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|