C13H17NO5 — CID 115122591
4-hydroxy-5-[(6-methyl-1,3-benzodioxol-5-yl)amino]pentanoic acid (PubChem CID 115122591) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-hydroxy-5-[(6-methyl-1,3-benzodioxol-5-yl)amino]pentanoic acid.
| Compound Name | 4-hydroxy-5-[(6-methyl-1,3-benzodioxol-5-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 115122591 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-hydroxy-5-[(6-methyl-1,3-benzodioxol-5-yl)amino]pentanoic acid |
| SMILES | Cc1cc2c(cc1NCC(O)CCC(=O)O)OCO2 |
| InChI | InChI=1S/C13H17NO5/c1-8-4-11-12(19-7-18-11)5-10(8)14-6-9(15)2-3-13(16)17/h4-5,9,14-15H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | MZPUQJJLLGWUCH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|