C13H16O4 — CID 116926956
2-methyl-4-(6-methyl-1,3-benzodioxol-5-yl)butanoic acid (PubChem CID 116926956) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-methyl-4-(6-methyl-1,3-benzodioxol-5-yl)butanoic acid.
| Compound Name | 2-methyl-4-(6-methyl-1,3-benzodioxol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 116926956 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-methyl-4-(6-methyl-1,3-benzodioxol-5-yl)butanoic acid |
| SMILES | Cc1cc2c(cc1CCC(C)C(=O)O)OCO2 |
| InChI | InChI=1S/C13H16O4/c1-8(13(14)15)3-4-10-6-12-11(5-9(10)2)16-7-17-12/h5-6,8H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | PEJDCLQBIOWNII-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |