C12H15NO3 — CID 115191234
N-[2-(6-methyl-1,3-benzodioxol-5-yl)ethyl]acetamide (PubChem CID 115191234) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-[2-(6-methyl-1,3-benzodioxol-5-yl)ethyl]acetamide.
| Compound Name | N-[2-(6-methyl-1,3-benzodioxol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 115191234 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-[2-(6-methyl-1,3-benzodioxol-5-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCc1cc2c(cc1C)OCO2 |
| InChI | InChI=1S/C12H15NO3/c1-8-5-11-12(16-7-15-11)6-10(8)3-4-13-9(2)14/h5-6H,3-4,7H2,1-2H3,(H,13,14) |
| InChIKey | NEEKCKPKJLHLTB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |