C11H15NO2 — CID 83698244
6-methyl-N-propan-2-yl-1,3-benzodioxol-5-amine (PubChem CID 83698244) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 6-methyl-N-propan-2-yl-1,3-benzodioxol-5-amine.
| Compound Name | 6-methyl-N-propan-2-yl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 83698244 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 6-methyl-N-propan-2-yl-1,3-benzodioxol-5-amine |
| SMILES | Cc1cc2c(cc1NC(C)C)OCO2 |
| InChI | InChI=1S/C11H15NO2/c1-7(2)12-9-5-11-10(4-8(9)3)13-6-14-11/h4-5,7,12H,6H2,1-3H3 |
| InChIKey | SYYYFVFOOIYUCQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|