C10H14N2O2 — CID 116939392
N'-methyl-1-(6-methyl-1,3-benzodioxol-5-yl)methanediamine (PubChem CID 116939392) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is N'-methyl-1-(6-methyl-1,3-benzodioxol-5-yl)methanediamine.
| Compound Name | N'-methyl-1-(6-methyl-1,3-benzodioxol-5-yl)methanediamine |
|---|---|
| PubChem CID | 116939392 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N'-methyl-1-(6-methyl-1,3-benzodioxol-5-yl)methanediamine |
| SMILES | CNC(N)c1cc2c(cc1C)OCO2 |
| InChI | InChI=1S/C10H14N2O2/c1-6-3-8-9(14-5-13-8)4-7(6)10(11)12-2/h3-4,10,12H,5,11H2,1-2H3 |
| InChIKey | NLTYNWXTJLJLDY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|