C11H16N2O2 — CID 116932852
1-(6-methyl-1,3-benzodioxol-5-yl)propane-1,3-diamine (PubChem CID 116932852) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(6-methyl-1,3-benzodioxol-5-yl)propane-1,3-diamine.
| Compound Name | 1-(6-methyl-1,3-benzodioxol-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116932852 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-(6-methyl-1,3-benzodioxol-5-yl)propane-1,3-diamine |
| SMILES | Cc1cc2c(cc1C(N)CCN)OCO2 |
| InChI | InChI=1S/C11H16N2O2/c1-7-4-10-11(15-6-14-10)5-8(7)9(13)2-3-12/h4-5,9H,2-3,6,12-13H2,1H3 |
| InChIKey | JWKDIUAJVUSUPR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |