C12H18BrClN2O2 — CID 171232796
(1S)-1-(6-bromo-1,3-benzodioxol-5-yl)pentane-1,5-diamine;hydrochloride (PubChem CID 171232796) has the molecular formula C12H18BrClN2O2 and a molecular weight of 337.65 g/mol. Its IUPAC name is (1S)-1-(6-bromo-1,3-benzodioxol-5-yl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-(6-bromo-1,3-benzodioxol-5-yl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171232796 |
| Molecular Formula | C12H18BrClN2O2 |
| Molecular Weight | 337.65 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | (1S)-1-(6-bromo-1,3-benzodioxol-5-yl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C12H17BrN2O2.ClH/c13-9-6-12-11(16-7-17-12)5-8(9)10(15)3-1-2-4-14;/h5-6,10H,1-4,7,14-15H2;1H/t10-;/m0./s1 |
| InChIKey | PLGMJQSQIRWAFU-PPHPATTJSA-N |
| XLogP | 2.73 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|