C11H15BrClNO2 — CID 171213180
(1R)-1-(6-bromo-1,3-benzodioxol-5-yl)butan-1-amine;hydrochloride (PubChem CID 171213180) has the molecular formula C11H15BrClNO2 and a molecular weight of 308.60 g/mol. Its IUPAC name is (1R)-1-(6-bromo-1,3-benzodioxol-5-yl)butan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(6-bromo-1,3-benzodioxol-5-yl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171213180 |
| Molecular Formula | C11H15BrClNO2 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | (1R)-1-(6-bromo-1,3-benzodioxol-5-yl)butan-1-amine;hydrochloride |
| SMILES | CCC[C@@H](N)c1cc2c(cc1Br)OCO2.Cl |
| InChI | InChI=1S/C11H14BrNO2.ClH/c1-2-3-9(13)7-4-10-11(5-8(7)12)15-6-14-10;/h4-5,9H,2-3,6,13H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | XMLXHUJYHPSHNS-SBSPUUFOSA-N |
| XLogP | 3.40 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |