C13H18BrNO2 — CID 171213184
(1R)-1-(6-bromo-1,3-benzodioxol-5-yl)hexan-1-amine (PubChem CID 171213184) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is (1R)-1-(6-bromo-1,3-benzodioxol-5-yl)hexan-1-amine.
| Compound Name | (1R)-1-(6-bromo-1,3-benzodioxol-5-yl)hexan-1-amine |
|---|---|
| PubChem CID | 171213184 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (1R)-1-(6-bromo-1,3-benzodioxol-5-yl)hexan-1-amine |
| SMILES | CCCCC[C@@H](N)c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C13H18BrNO2/c1-2-3-4-5-11(15)9-6-12-13(7-10(9)14)17-8-16-12/h6-7,11H,2-5,8,15H2,1H3/t11-/m1/s1 |
| InChIKey | HONOFMONIGZOOG-LLVKDONJSA-N |
| XLogP | 3.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|