C17H25BrN2O2 — CID 171308271
1-[(1R)-1-(6-bromo-1,3-benzodioxol-5-yl)hexyl]piperazine (PubChem CID 171308271) has the molecular formula C17H25BrN2O2 and a molecular weight of 369.30 g/mol. Its IUPAC name is 1-[(1R)-1-(6-bromo-1,3-benzodioxol-5-yl)hexyl]piperazine.
| Compound Name | 1-[(1R)-1-(6-bromo-1,3-benzodioxol-5-yl)hexyl]piperazine |
|---|---|
| PubChem CID | 171308271 |
| Molecular Formula | C17H25BrN2O2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[(1R)-1-(6-bromo-1,3-benzodioxol-5-yl)hexyl]piperazine |
| SMILES | CCCCC[C@H](c1cc2c(cc1Br)OCO2)N1CCNCC1 |
| InChI | InChI=1S/C17H25BrN2O2/c1-2-3-4-5-15(20-8-6-19-7-9-20)13-10-16-17(11-14(13)18)22-12-21-16/h10-11,15,19H,2-9,12H2,1H3/t15-/m1/s1 |
| InChIKey | PQMSVHGVCUQYCH-OAHLLOKOSA-N |
| XLogP | 3.70 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|