C16H23ClN2O2 — CID 171309691
1-[(1S)-1-(6-chloro-1,3-benzodioxol-5-yl)pentyl]piperazine (PubChem CID 171309691) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 1-[(1S)-1-(6-chloro-1,3-benzodioxol-5-yl)pentyl]piperazine.
| Compound Name | 1-[(1S)-1-(6-chloro-1,3-benzodioxol-5-yl)pentyl]piperazine |
|---|---|
| PubChem CID | 171309691 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-[(1S)-1-(6-chloro-1,3-benzodioxol-5-yl)pentyl]piperazine |
| SMILES | CCCC[C@@H](c1cc2c(cc1Cl)OCO2)N1CCNCC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-2-3-4-14(19-7-5-18-6-8-19)12-9-15-16(10-13(12)17)21-11-20-15/h9-10,14,18H,2-8,11H2,1H3/t14-/m0/s1 |
| InChIKey | RFSKNTAVFHLPAG-AWEZNQCLSA-N |
| XLogP | 3.21 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |