C14H17ClF2N2O2 — CID 171177911
1-[(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-3,3-difluoropropyl]piperazine (PubChem CID 171177911) has the molecular formula C14H17ClF2N2O2 and a molecular weight of 318.75 g/mol. Its IUPAC name is 1-[(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-3,3-difluoropropyl]piperazine.
| Compound Name | 1-[(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-3,3-difluoropropyl]piperazine |
|---|---|
| PubChem CID | 171177911 |
| Molecular Formula | C14H17ClF2N2O2 |
| Molecular Weight | 318.75 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-[(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-3,3-difluoropropyl]piperazine |
| SMILES | FC(F)C[C@H](c1cc2c(cc1Cl)OCO2)N1CCNCC1 |
| InChI | InChI=1S/C14H17ClF2N2O2/c15-10-6-13-12(20-8-21-13)5-9(10)11(7-14(16)17)19-3-1-18-2-4-19/h5-6,11,14,18H,1-4,7-8H2/t11-/m1/s1 |
| InChIKey | XCRNROZHMKLSSY-LLVKDONJSA-N |
| XLogP | 2.67 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |