C16H23Cl3N2O2 — CID 171283462
1-[(1S)-1-(6-chloro-1,3-benzodioxol-5-yl)pent-4-enyl]piperazine;dihydrochloride (PubChem CID 171283462) has the molecular formula C16H23Cl3N2O2 and a molecular weight of 381.73 g/mol. Its IUPAC name is 1-[(1S)-1-(6-chloro-1,3-benzodioxol-5-yl)pent-4-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(6-chloro-1,3-benzodioxol-5-yl)pent-4-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171283462 |
| Molecular Formula | C16H23Cl3N2O2 |
| Molecular Weight | 381.73 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-[(1S)-1-(6-chloro-1,3-benzodioxol-5-yl)pent-4-enyl]piperazine;dihydrochloride |
| SMILES | C=CCC[C@@H](c1cc2c(cc1Cl)OCO2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H21ClN2O2.2ClH/c1-2-3-4-14(19-7-5-18-6-8-19)12-9-15-16(10-13(12)17)21-11-20-15;;/h2,9-10,14,18H,1,3-8,11H2;2*1H/t14-;;/m0../s1 |
| InChIKey | KPUJUADLMAEMTP-UTLKBRERSA-N |
| XLogP | 3.82 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|