C12H15Cl2NO2 — CID 171215162
(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)pent-4-en-1-amine;hydrochloride (PubChem CID 171215162) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)pent-4-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171215162 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1cc2c(cc1Cl)OCO2.Cl |
| InChI | InChI=1S/C12H14ClNO2.ClH/c1-2-3-4-10(14)8-5-11-12(6-9(8)13)16-7-15-11;/h2,5-6,10H,1,3-4,7,14H2;1H/t10-;/m1./s1 |
| InChIKey | KNIQPCCKSPGEJB-HNCPQSOCSA-N |
| XLogP | 3.46 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|