C10H10ClNO2 — CID 131223734
(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)prop-2-en-1-amine (PubChem CID 131223734) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)prop-2-en-1-amine.
| Compound Name | (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 131223734 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)prop-2-en-1-amine |
| SMILES | C=C[C@@H](N)c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C10H10ClNO2/c1-2-8(12)6-3-9-10(4-7(6)11)14-5-13-9/h2-4,8H,1,5,12H2/t8-/m1/s1 |
| InChIKey | KIFPAFUOUOBBOL-MRVPVSSYSA-N |
| XLogP | 2.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|