C10H10ClNO4 — CID 131278092
methyl (2S)-2-amino-2-(6-chloro-1,3-benzodioxol-5-yl)acetate (PubChem CID 131278092) has the molecular formula C10H10ClNO4 and a molecular weight of 243.65 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(6-chloro-1,3-benzodioxol-5-yl)acetate.
| Compound Name | methyl (2S)-2-amino-2-(6-chloro-1,3-benzodioxol-5-yl)acetate |
|---|---|
| PubChem CID | 131278092 |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | methyl (2S)-2-amino-2-(6-chloro-1,3-benzodioxol-5-yl)acetate |
| SMILES | COC(=O)[C@@H](N)c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C10H10ClNO4/c1-14-10(13)9(12)5-2-7-8(3-6(5)11)16-4-15-7/h2-3,9H,4,12H2,1H3/t9-/m0/s1 |
| InChIKey | UWJSOQUUQPJMMV-VIFPVBQESA-N |
| XLogP | 1.24 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |