C15H21ClNO4+ — CID 23285599
[2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium (PubChem CID 23285599) has the molecular formula C15H21ClNO4+ and a molecular weight of 314.79 g/mol. Its IUPAC name is [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium.
| Compound Name | [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium |
|---|---|
| PubChem CID | 23285599 |
| Molecular Formula | C15H21ClNO4+ |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3-methoxy-3-oxopropyl]-trimethylazanium |
| SMILES | COC(=O)C(Cc1cc2c(cc1Cl)OCO2)C[N+](C)(C)C |
| InChI | InChI=1S/C15H21ClNO4/c1-17(2,3)8-11(15(18)19-4)5-10-6-13-14(7-12(10)16)21-9-20-13/h6-7,11H,5,8-9H2,1-4H3/q+1 |
| InChIKey | HAKPOOYYAHMWMV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|