C11H14N2O3 — CID 116850457
2-amino-N-methyl-2-(6-methyl-1,3-benzodioxol-5-yl)acetamide (PubChem CID 116850457) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-amino-N-methyl-2-(6-methyl-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-amino-N-methyl-2-(6-methyl-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 116850457 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-amino-N-methyl-2-(6-methyl-1,3-benzodioxol-5-yl)acetamide |
| SMILES | CNC(=O)C(N)c1cc2c(cc1C)OCO2 |
| InChI | InChI=1S/C11H14N2O3/c1-6-3-8-9(16-5-15-8)4-7(6)10(12)11(14)13-2/h3-4,10H,5,12H2,1-2H3,(H,13,14) |
| InChIKey | APNIAXDKCQPQBL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |