C11H16N2O3 — CID 116942599
1,3-diamino-1-(6-methyl-1,3-benzodioxol-5-yl)propan-2-ol (PubChem CID 116942599) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1,3-diamino-1-(6-methyl-1,3-benzodioxol-5-yl)propan-2-ol.
| Compound Name | 1,3-diamino-1-(6-methyl-1,3-benzodioxol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 116942599 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1,3-diamino-1-(6-methyl-1,3-benzodioxol-5-yl)propan-2-ol |
| SMILES | Cc1cc2c(cc1C(N)C(O)CN)OCO2 |
| InChI | InChI=1S/C11H16N2O3/c1-6-2-9-10(16-5-15-9)3-7(6)11(13)8(14)4-12/h2-3,8,11,14H,4-5,12-13H2,1H3 |
| InChIKey | LPWHVGDONBNHEC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |