C10H10F3NO2 — CID 116947211
2,2,2-trifluoro-1-(6-methyl-1,3-benzodioxol-5-yl)ethanamine (PubChem CID 116947211) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(6-methyl-1,3-benzodioxol-5-yl)ethanamine.
| Compound Name | 2,2,2-trifluoro-1-(6-methyl-1,3-benzodioxol-5-yl)ethanamine |
|---|---|
| PubChem CID | 116947211 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(6-methyl-1,3-benzodioxol-5-yl)ethanamine |
| SMILES | Cc1cc2c(cc1C(N)C(F)(F)F)OCO2 |
| InChI | InChI=1S/C10H10F3NO2/c1-5-2-7-8(16-4-15-7)3-6(5)9(14)10(11,12)13/h2-3,9H,4,14H2,1H3 |
| InChIKey | OOMMDJPRZRATSR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |