C11H14F3N — CID 77128155
2,2,2-trifluoro-1-(2,4,5-trimethylphenyl)ethanamine (PubChem CID 77128155) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2,4,5-trimethylphenyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-1-(2,4,5-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 77128155 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2,2,2-trifluoro-1-(2,4,5-trimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(C(N)C(F)(F)F)cc1C |
| InChI | InChI=1S/C11H14F3N/c1-6-4-8(3)9(5-7(6)2)10(15)11(12,13)14/h4-5,10H,15H2,1-3H3 |
| InChIKey | RSGAVJHVHSDGFA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |