C9H9F4NO — CID 66511370
2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluoro-5-methylphenol (PubChem CID 66511370) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluoro-5-methylphenol.
| Compound Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluoro-5-methylphenol |
|---|---|
| PubChem CID | 66511370 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluoro-5-methylphenol |
| SMILES | Cc1cc(O)c([C@@H](N)C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H9F4NO/c1-4-2-7(15)5(3-6(4)10)8(14)9(11,12)13/h2-3,8,15H,14H2,1H3/t8-/m1/s1 |
| InChIKey | XFEOFFTZQVGZDP-MRVPVSSYSA-N |
| XLogP | 2.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|