About 4-fluoro-2,5-dimethylphenol
4-fluoro-2,5-dimethylphenol (PubChem CID 22627623) has the molecular formula C8H9FO
and a molecular weight of 140.16 g/mol. Its IUPAC name is 4-fluoro-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-fluoro-2,5-dimethylphenol |
| PubChem CID | 22627623 |
| Molecular Formula | C8H9FO |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 4-fluoro-2,5-dimethylphenol |
| SMILES | Cc1cc(F)c(C)cc1O |
| InChI | InChI=1S/C8H9FO/c1-5-4-8(10)6(2)3-7(5)9/h3-4,10H,1-2H3 |
| InChIKey | SZAAQEQSQLOKQW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,5-dimethylphenol?
The IUPAC name of 4-fluoro-2,5-dimethylphenol (CID 22627623) is 4-fluoro-2,5-dimethylphenol.
What is the SMILES notation for 4-fluoro-2,5-dimethylphenol?
The canonical SMILES for 4-fluoro-2,5-dimethylphenol is Cc1cc(F)c(C)cc1O.
What is the InChIKey of 4-fluoro-2,5-dimethylphenol?
The InChIKey is SZAAQEQSQLOKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO/c1-5-4-8(10)6(2)3-7(5)9/h3-4,10H,1-2H3.
What are the key properties of 4-fluoro-2,5-dimethylphenol?
4-fluoro-2,5-dimethylphenol has a molecular weight of 140.16 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,5-dimethylphenol is sourced from PubChem (CID 22627623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).