About 3,5-dimethylphenol
3,5-dimethylphenol (PubChem CID 7948) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 3,5-dimethylphenol.
Molecular Properties
| Compound Name | 3,5-dimethylphenol |
| PubChem CID | 7948 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 3,5-dimethylphenol |
| SMILES | Cc1cc(C)cc(O)c1 |
| InChI | InChI=1S/C8H10O/c1-6-3-7(2)5-8(9)4-6/h3-5,9H,1-2H3 |
| InChIKey | TUAMRELNJMMDMT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylphenol?
The IUPAC name of 3,5-dimethylphenol (CID 7948) is 3,5-dimethylphenol.
What is the SMILES notation for 3,5-dimethylphenol?
The canonical SMILES for 3,5-dimethylphenol is Cc1cc(C)cc(O)c1.
What is the InChIKey of 3,5-dimethylphenol?
The InChIKey is TUAMRELNJMMDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-6-3-7(2)5-8(9)4-6/h3-5,9H,1-2H3.
What are the key properties of 3,5-dimethylphenol?
3,5-dimethylphenol has a molecular weight of 122.17 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylphenol is sourced from PubChem (CID 7948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).