C8H7F3INO — CID 66512553
2-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-iodophenol (PubChem CID 66512553) has the molecular formula C8H7F3INO and a molecular weight of 317.05 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-iodophenol.
| Compound Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-iodophenol |
|---|---|
| PubChem CID | 66512553 |
| Molecular Formula | C8H7F3INO |
| Molecular Weight | 317.05 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-iodophenol |
| SMILES | N[C@@H](c1ccc(I)cc1O)C(F)(F)F |
| InChI | InChI=1S/C8H7F3INO/c9-8(10,11)7(13)5-2-1-4(12)3-6(5)14/h1-3,7,14H,13H2/t7-/m0/s1 |
| InChIKey | WEBNDFAWCOHOTA-ZETCQYMHSA-N |
| XLogP | 2.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.05 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|