C8H8F3NO3 — CID 130059147
4-(1-amino-2,2,2-trifluoroethyl)benzene-1,2,3-triol (PubChem CID 130059147) has the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. Its IUPAC name is 4-(1-amino-2,2,2-trifluoroethyl)benzene-1,2,3-triol.
| Compound Name | 4-(1-amino-2,2,2-trifluoroethyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 130059147 |
| Molecular Formula | C8H8F3NO3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 4-(1-amino-2,2,2-trifluoroethyl)benzene-1,2,3-triol |
| SMILES | NC(c1ccc(O)c(O)c1O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO3/c9-8(10,11)7(12)3-1-2-4(13)6(15)5(3)14/h1-2,7,13-15H,12H2 |
| InChIKey | WNPLWQYGTVKQEK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|