C9H11F2NO4 — CID 131542064
4-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]benzene-1,2,3-triol (PubChem CID 131542064) has the molecular formula C9H11F2NO4 and a molecular weight of 235.19 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]benzene-1,2,3-triol.
| Compound Name | 4-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 131542064 |
| Molecular Formula | C9H11F2NO4 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 4-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]benzene-1,2,3-triol |
| SMILES | N[C@@H](c1ccc(O)c(O)c1O)C(F)(F)CO |
| InChI | InChI=1S/C9H11F2NO4/c10-9(11,3-13)8(12)4-1-2-5(14)7(16)6(4)15/h1-2,8,13-16H,3,12H2/t8-/m0/s1 |
| InChIKey | GOSGJLFMYORDPF-QMMMGPOBSA-N |
| XLogP | 0.43 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|