C10H13F2NO2 — CID 131543744
2-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-methylphenol (PubChem CID 131543744) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-methylphenol.
| Compound Name | 2-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-methylphenol |
|---|---|
| PubChem CID | 131543744 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-methylphenol |
| SMILES | Cc1cccc([C@H](N)C(F)(F)CO)c1O |
| InChI | InChI=1S/C10H13F2NO2/c1-6-3-2-4-7(8(6)15)9(13)10(11,12)5-14/h2-4,9,14-15H,5,13H2,1H3/t9-/m0/s1 |
| InChIKey | XDGAROKLTRAEJM-VIFPVBQESA-N |
| XLogP | 1.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|