C12H19NO — CID 130731500
2-[(1R)-1-amino-2,2-dimethylpropyl]-6-methylphenol (PubChem CID 130731500) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-dimethylpropyl]-6-methylphenol.
| Compound Name | 2-[(1R)-1-amino-2,2-dimethylpropyl]-6-methylphenol |
|---|---|
| PubChem CID | 130731500 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-dimethylpropyl]-6-methylphenol |
| SMILES | Cc1cccc([C@H](N)C(C)(C)C)c1O |
| InChI | InChI=1S/C12H19NO/c1-8-6-5-7-9(10(8)14)11(13)12(2,3)4/h5-7,11,14H,13H2,1-4H3/t11-/m0/s1 |
| InChIKey | AWGBNHNQWIUHFK-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|