C12H17NO2 — CID 171270321
2-[(1S,2R)-1-amino-2-cyclopropyl-2-hydroxyethyl]-6-methylphenol (PubChem CID 171270321) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-cyclopropyl-2-hydroxyethyl]-6-methylphenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-cyclopropyl-2-hydroxyethyl]-6-methylphenol |
|---|---|
| PubChem CID | 171270321 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-cyclopropyl-2-hydroxyethyl]-6-methylphenol |
| SMILES | Cc1cccc([C@H](N)[C@H](O)C2CC2)c1O |
| InChI | InChI=1S/C12H17NO2/c1-7-3-2-4-9(11(7)14)10(13)12(15)8-5-6-8/h2-4,8,10,12,14-15H,5-6,13H2,1H3/t10-,12+/m0/s1 |
| InChIKey | LIRMDPITRSOQJW-CMPLNLGQSA-N |
| XLogP | 1.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|