C12H16ClNO2 — CID 171268082
2-[(1S,2R)-1-amino-2-cyclobutyl-2-hydroxyethyl]-6-chlorophenol (PubChem CID 171268082) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-cyclobutyl-2-hydroxyethyl]-6-chlorophenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-cyclobutyl-2-hydroxyethyl]-6-chlorophenol |
|---|---|
| PubChem CID | 171268082 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-cyclobutyl-2-hydroxyethyl]-6-chlorophenol |
| SMILES | N[C@@H](c1cccc(Cl)c1O)[C@H](O)C1CCC1 |
| InChI | InChI=1S/C12H16ClNO2/c13-9-6-2-5-8(12(9)16)10(14)11(15)7-3-1-4-7/h2,5-7,10-11,15-16H,1,3-4,14H2/t10-,11+/m0/s1 |
| InChIKey | GSXLZGRZEIHRLN-WDEREUQCSA-N |
| XLogP | 2.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|